[4-(4-methylbenzene-1-sulfonyl)piperazin-1-yl](2-methylphenyl)methanone
Chemical Structure Depiction of
[4-(4-methylbenzene-1-sulfonyl)piperazin-1-yl](2-methylphenyl)methanone
[4-(4-methylbenzene-1-sulfonyl)piperazin-1-yl](2-methylphenyl)methanone
Compound characteristics
| Compound ID: | Y206-9827 |
| Compound Name: | [4-(4-methylbenzene-1-sulfonyl)piperazin-1-yl](2-methylphenyl)methanone |
| Molecular Weight: | 358.46 |
| Molecular Formula: | C19 H22 N2 O3 S |
| Smiles: | Cc1ccc(cc1)S(N1CCN(CC1)C(c1ccccc1C)=O)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.9786 |
| logD: | 2.9786 |
| logSw: | -3.4103 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 48.405 |
| InChI Key: | QKPQMBVQGFGNPC-UHFFFAOYSA-N |