cyclobutyl[4-(3,4-dimethoxybenzene-1-sulfonyl)piperazin-1-yl]methanone
Chemical Structure Depiction of
cyclobutyl[4-(3,4-dimethoxybenzene-1-sulfonyl)piperazin-1-yl]methanone
cyclobutyl[4-(3,4-dimethoxybenzene-1-sulfonyl)piperazin-1-yl]methanone
Compound characteristics
| Compound ID: | Y207-0217 |
| Compound Name: | cyclobutyl[4-(3,4-dimethoxybenzene-1-sulfonyl)piperazin-1-yl]methanone |
| Molecular Weight: | 368.45 |
| Molecular Formula: | C17 H24 N2 O5 S |
| Smiles: | COc1ccc(cc1OC)S(N1CCN(CC1)C(C1CCC1)=O)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 1.0861 |
| logD: | 1.0861 |
| logSw: | -2.4295 |
| Hydrogen bond acceptors count: | 9 |
| Polar surface area: | 64.189 |
| InChI Key: | DVOLDMDPRWSKBM-UHFFFAOYSA-N |