(5-chlorothiophen-2-yl){4-[3-(trifluoromethyl)phenyl]piperazin-1-yl}methanone
Chemical Structure Depiction of
(5-chlorothiophen-2-yl){4-[3-(trifluoromethyl)phenyl]piperazin-1-yl}methanone
(5-chlorothiophen-2-yl){4-[3-(trifluoromethyl)phenyl]piperazin-1-yl}methanone
Compound characteristics
| Compound ID: | Y207-0457 |
| Compound Name: | (5-chlorothiophen-2-yl){4-[3-(trifluoromethyl)phenyl]piperazin-1-yl}methanone |
| Molecular Weight: | 374.81 |
| Molecular Formula: | C16 H14 Cl F3 N2 O S |
| Smiles: | C1CN(CCN1C(c1ccc(s1)[Cl])=O)c1cccc(c1)C(F)(F)F |
| Stereo: | ACHIRAL |
| logP: | 4.4211 |
| logD: | 4.4211 |
| logSw: | -4.6073 |
| Hydrogen bond acceptors count: | 2 |
| Polar surface area: | 21.1654 |
| InChI Key: | OCQKZLLFPUSGRZ-UHFFFAOYSA-N |