N-(butan-2-yl)-N'-[(3,4-dimethoxyphenyl)methyl]urea
Chemical Structure Depiction of
N-(butan-2-yl)-N'-[(3,4-dimethoxyphenyl)methyl]urea
N-(butan-2-yl)-N'-[(3,4-dimethoxyphenyl)methyl]urea
Compound characteristics
| Compound ID: | Y207-0807 |
| Compound Name: | N-(butan-2-yl)-N'-[(3,4-dimethoxyphenyl)methyl]urea |
| Molecular Weight: | 266.34 |
| Molecular Formula: | C14 H22 N2 O3 |
| Smiles: | CCC(C)NC(NCc1ccc(c(c1)OC)OC)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 1.5474 |
| logD: | 1.5474 |
| logSw: | -2.0221 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 50.16 |
| InChI Key: | VMPWZPLBRIBARL-JTQLQIEISA-N |