N,N'-[1,3-phenylenebis(methylene)]bis(2-fluorobenzamide)
Chemical Structure Depiction of
N,N'-[1,3-phenylenebis(methylene)]bis(2-fluorobenzamide)
N,N'-[1,3-phenylenebis(methylene)]bis(2-fluorobenzamide)
Compound characteristics
| Compound ID: | Y207-1158 |
| Compound Name: | N,N'-[1,3-phenylenebis(methylene)]bis(2-fluorobenzamide) |
| Molecular Weight: | 380.39 |
| Molecular Formula: | C22 H18 F2 N2 O2 |
| Smiles: | C(c1cccc(CNC(c2ccccc2F)=O)c1)NC(c1ccccc1F)=O |
| Stereo: | ACHIRAL |
| logP: | 3.8437 |
| logD: | 3.8435 |
| logSw: | -4.1748 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 49.065 |
| InChI Key: | UJGJQINMTPQVQZ-UHFFFAOYSA-N |