N-[4-(2,5-dimethylphenyl)-5-methyl-1,3-thiazol-2-yl]-2-methylfuran-3-carboxamide
Chemical Structure Depiction of
N-[4-(2,5-dimethylphenyl)-5-methyl-1,3-thiazol-2-yl]-2-methylfuran-3-carboxamide
N-[4-(2,5-dimethylphenyl)-5-methyl-1,3-thiazol-2-yl]-2-methylfuran-3-carboxamide
Compound characteristics
| Compound ID: | Y207-1725 |
| Compound Name: | N-[4-(2,5-dimethylphenyl)-5-methyl-1,3-thiazol-2-yl]-2-methylfuran-3-carboxamide |
| Molecular Weight: | 326.42 |
| Molecular Formula: | C18 H18 N2 O2 S |
| Smiles: | Cc1ccc(C)c(c1)c1c(C)sc(NC(c2ccoc2C)=O)n1 |
| Stereo: | ACHIRAL |
| logP: | 4.8192 |
| logD: | 4.8187 |
| logSw: | -4.525 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 42.108 |
| InChI Key: | JTPDAQUHMMQKAJ-UHFFFAOYSA-N |