4-butyl-N-(2-methylphenyl)benzene-1-sulfonamide
Chemical Structure Depiction of
4-butyl-N-(2-methylphenyl)benzene-1-sulfonamide
4-butyl-N-(2-methylphenyl)benzene-1-sulfonamide
Compound characteristics
| Compound ID: | Y207-2234 |
| Compound Name: | 4-butyl-N-(2-methylphenyl)benzene-1-sulfonamide |
| Molecular Weight: | 303.42 |
| Molecular Formula: | C17 H21 N O2 S |
| Smiles: | CCCCc1ccc(cc1)S(Nc1ccccc1C)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.9423 |
| logD: | 4.9139 |
| logSw: | -4.5949 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 40.19 |
| InChI Key: | ZLEAOIHIPDQVOE-UHFFFAOYSA-N |