N-(3,5-dimethoxyphenyl)-2,5-difluorobenzene-1-sulfonamide
Chemical Structure Depiction of
N-(3,5-dimethoxyphenyl)-2,5-difluorobenzene-1-sulfonamide
N-(3,5-dimethoxyphenyl)-2,5-difluorobenzene-1-sulfonamide
Compound characteristics
| Compound ID: | Y207-3932 |
| Compound Name: | N-(3,5-dimethoxyphenyl)-2,5-difluorobenzene-1-sulfonamide |
| Molecular Weight: | 329.32 |
| Molecular Formula: | C14 H13 F2 N O4 S |
| Smiles: | COc1cc(cc(c1)OC)NS(c1cc(ccc1F)F)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.0199 |
| logD: | 2.3637 |
| logSw: | -3.436 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 55.976 |
| InChI Key: | NMXIMNXBGNBEIY-UHFFFAOYSA-N |