N-(3,5-dichlorophenyl)-N'-(pyrazin-2-yl)urea
Chemical Structure Depiction of
N-(3,5-dichlorophenyl)-N'-(pyrazin-2-yl)urea
N-(3,5-dichlorophenyl)-N'-(pyrazin-2-yl)urea
Compound characteristics
| Compound ID: | Y207-4125 |
| Compound Name: | N-(3,5-dichlorophenyl)-N'-(pyrazin-2-yl)urea |
| Molecular Weight: | 283.11 |
| Molecular Formula: | C11 H8 Cl2 N4 O |
| Smiles: | c1c(cc(cc1[Cl])[Cl])NC(Nc1cnccn1)=O |
| Stereo: | ACHIRAL |
| logP: | 3.6132 |
| logD: | 3.6065 |
| logSw: | -3.8483 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 51.674 |
| InChI Key: | XAUOSOQLCPSEID-UHFFFAOYSA-N |