3-(3,4-dimethoxyphenyl)-4-ethyl-5-{[(3-methoxyphenyl)methyl]sulfanyl}-4H-1,2,4-triazole
Chemical Structure Depiction of
3-(3,4-dimethoxyphenyl)-4-ethyl-5-{[(3-methoxyphenyl)methyl]sulfanyl}-4H-1,2,4-triazole
3-(3,4-dimethoxyphenyl)-4-ethyl-5-{[(3-methoxyphenyl)methyl]sulfanyl}-4H-1,2,4-triazole
Compound characteristics
| Compound ID: | Y207-4391 |
| Compound Name: | 3-(3,4-dimethoxyphenyl)-4-ethyl-5-{[(3-methoxyphenyl)methyl]sulfanyl}-4H-1,2,4-triazole |
| Molecular Weight: | 385.48 |
| Molecular Formula: | C20 H23 N3 O3 S |
| Smiles: | CCn1c(c2ccc(c(c2)OC)OC)nnc1SCc1cccc(c1)OC |
| Stereo: | ACHIRAL |
| logP: | 4.1093 |
| logD: | 4.1093 |
| logSw: | -4.3345 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 46.77 |
| InChI Key: | CJYHEIJNAGVLAH-UHFFFAOYSA-N |