N-[(4-methoxyphenyl)methyl]-2-{[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]methoxy}benzamide
Chemical Structure Depiction of
N-[(4-methoxyphenyl)methyl]-2-{[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]methoxy}benzamide
N-[(4-methoxyphenyl)methyl]-2-{[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]methoxy}benzamide
Compound characteristics
| Compound ID: | Y207-4428 |
| Compound Name: | N-[(4-methoxyphenyl)methyl]-2-{[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]methoxy}benzamide |
| Molecular Weight: | 429.47 |
| Molecular Formula: | C25 H23 N3 O4 |
| Smiles: | Cc1ccc(cc1)c1nc(COc2ccccc2C(NCc2ccc(cc2)OC)=O)on1 |
| Stereo: | ACHIRAL |
| logP: | 5.268 |
| logD: | 5.2679 |
| logSw: | -5.1523 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 70.853 |
| InChI Key: | WUWYZGJOCWARPN-UHFFFAOYSA-N |