N-(2,5-difluorophenyl)-2,4,5-trimethylbenzene-1-sulfonamide
Chemical Structure Depiction of
N-(2,5-difluorophenyl)-2,4,5-trimethylbenzene-1-sulfonamide
N-(2,5-difluorophenyl)-2,4,5-trimethylbenzene-1-sulfonamide
Compound characteristics
| Compound ID: | Y207-4984 |
| Compound Name: | N-(2,5-difluorophenyl)-2,4,5-trimethylbenzene-1-sulfonamide |
| Molecular Weight: | 311.35 |
| Molecular Formula: | C15 H15 F2 N O2 S |
| Smiles: | Cc1cc(C)c(cc1C)S(Nc1cc(ccc1F)F)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.4274 |
| logD: | 1.3698 |
| logSw: | -4.3018 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 40.19 |
| InChI Key: | PNPJKMGBOZCQFL-UHFFFAOYSA-N |