N-(2,3-dihydro-1H-inden-5-yl)-3-fluorobenzene-1-sulfonamide
Chemical Structure Depiction of
N-(2,3-dihydro-1H-inden-5-yl)-3-fluorobenzene-1-sulfonamide
N-(2,3-dihydro-1H-inden-5-yl)-3-fluorobenzene-1-sulfonamide
Compound characteristics
| Compound ID: | Y207-5204 |
| Compound Name: | N-(2,3-dihydro-1H-inden-5-yl)-3-fluorobenzene-1-sulfonamide |
| Molecular Weight: | 291.34 |
| Molecular Formula: | C15 H14 F N O2 S |
| Smiles: | C1Cc2ccc(cc2C1)NS(c1cccc(c1)F)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.7393 |
| logD: | 3.7255 |
| logSw: | -3.9271 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 41.175 |
| InChI Key: | PVPVDMIQBCNTKE-UHFFFAOYSA-N |