3-fluoro-N-(1-phenylethyl)benzene-1-sulfonamide
Chemical Structure Depiction of
3-fluoro-N-(1-phenylethyl)benzene-1-sulfonamide
3-fluoro-N-(1-phenylethyl)benzene-1-sulfonamide
Compound characteristics
| Compound ID: | Y207-5261 |
| Compound Name: | 3-fluoro-N-(1-phenylethyl)benzene-1-sulfonamide |
| Molecular Weight: | 279.33 |
| Molecular Formula: | C14 H14 F N O2 S |
| Smiles: | CC(c1ccccc1)NS(c1cccc(c1)F)(=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.2288 |
| logD: | 3.2286 |
| logSw: | -3.5417 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 41.373 |
| InChI Key: | CYMYPJHEOZTMTR-NSHDSACASA-N |