N-(2-{[(2-chlorophenyl)methyl]sulfanyl}ethyl)-1-(methanesulfonyl)piperidine-4-carboxamide
Chemical Structure Depiction of
N-(2-{[(2-chlorophenyl)methyl]sulfanyl}ethyl)-1-(methanesulfonyl)piperidine-4-carboxamide
N-(2-{[(2-chlorophenyl)methyl]sulfanyl}ethyl)-1-(methanesulfonyl)piperidine-4-carboxamide
Compound characteristics
| Compound ID: | Y300-0241 |
| Compound Name: | N-(2-{[(2-chlorophenyl)methyl]sulfanyl}ethyl)-1-(methanesulfonyl)piperidine-4-carboxamide |
| Molecular Weight: | 390.95 |
| Molecular Formula: | C16 H23 Cl N2 O3 S2 |
| Smiles: | CS(N1CCC(CC1)C(NCCSCc1ccccc1[Cl])=O)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.2653 |
| logD: | 2.2653 |
| logSw: | -3.0524 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 55.968 |
| InChI Key: | LFKMSHVOYXKLTO-UHFFFAOYSA-N |