N-(5-{[(2-fluorophenyl)methyl]sulfamoyl}-2-methoxyphenyl)acetamide
Chemical Structure Depiction of
N-(5-{[(2-fluorophenyl)methyl]sulfamoyl}-2-methoxyphenyl)acetamide
N-(5-{[(2-fluorophenyl)methyl]sulfamoyl}-2-methoxyphenyl)acetamide
Compound characteristics
| Compound ID: | Y300-0371 |
| Compound Name: | N-(5-{[(2-fluorophenyl)methyl]sulfamoyl}-2-methoxyphenyl)acetamide |
| Molecular Weight: | 352.38 |
| Molecular Formula: | C16 H17 F N2 O4 S |
| Smiles: | CC(Nc1cc(ccc1OC)S(NCc1ccccc1F)(=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 1.9054 |
| logD: | 1.9031 |
| logSw: | -2.7669 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 72.191 |
| InChI Key: | CQFVBCICNUXIKZ-UHFFFAOYSA-N |