1-(ethanesulfonyl)-N-methyl-N-phenylpiperidine-4-carboxamide
Chemical Structure Depiction of
1-(ethanesulfonyl)-N-methyl-N-phenylpiperidine-4-carboxamide
1-(ethanesulfonyl)-N-methyl-N-phenylpiperidine-4-carboxamide
Compound characteristics
| Compound ID: | Y300-1549 |
| Compound Name: | 1-(ethanesulfonyl)-N-methyl-N-phenylpiperidine-4-carboxamide |
| Molecular Weight: | 310.41 |
| Molecular Formula: | C15 H22 N2 O3 S |
| Smiles: | CCS(N1CCC(CC1)C(N(C)c1ccccc1)=O)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 1.1546 |
| logD: | 1.1546 |
| logSw: | -2.2509 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 47.484 |
| InChI Key: | YZGJHXORXJQPJV-UHFFFAOYSA-N |