1-(3-chlorophenyl)-4-[(4-fluorophenyl)methanesulfonyl]piperazine
Chemical Structure Depiction of
1-(3-chlorophenyl)-4-[(4-fluorophenyl)methanesulfonyl]piperazine
1-(3-chlorophenyl)-4-[(4-fluorophenyl)methanesulfonyl]piperazine
Compound characteristics
| Compound ID: | Y300-2611 |
| Compound Name: | 1-(3-chlorophenyl)-4-[(4-fluorophenyl)methanesulfonyl]piperazine |
| Molecular Weight: | 368.86 |
| Molecular Formula: | C17 H18 Cl F N2 O2 S |
| Smiles: | C1CN(CCN1c1cccc(c1)[Cl])S(Cc1ccc(cc1)F)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.2207 |
| logD: | 3.2207 |
| logSw: | -3.4658 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 35.104 |
| InChI Key: | CNPUJKTWRSSTJX-UHFFFAOYSA-N |