N-[(4-methoxyphenyl)methyl]-1-(3-methylphenyl)methanesulfonamide
Chemical Structure Depiction of
N-[(4-methoxyphenyl)methyl]-1-(3-methylphenyl)methanesulfonamide
N-[(4-methoxyphenyl)methyl]-1-(3-methylphenyl)methanesulfonamide
Compound characteristics
| Compound ID: | Y300-2964 |
| Compound Name: | N-[(4-methoxyphenyl)methyl]-1-(3-methylphenyl)methanesulfonamide |
| Molecular Weight: | 305.39 |
| Molecular Formula: | C16 H19 N O3 S |
| Smiles: | Cc1cccc(CS(NCc2ccc(cc2)OC)(=O)=O)c1 |
| Stereo: | ACHIRAL |
| logP: | 3.447 |
| logD: | 3.447 |
| logSw: | -3.6954 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 51.167 |
| InChI Key: | PMNZUJIDYASUAK-UHFFFAOYSA-N |