N-[3-chloro-4-(morpholine-4-carbonyl)phenyl]-N-methylbenzenesulfonamide
Chemical Structure Depiction of
N-[3-chloro-4-(morpholine-4-carbonyl)phenyl]-N-methylbenzenesulfonamide
N-[3-chloro-4-(morpholine-4-carbonyl)phenyl]-N-methylbenzenesulfonamide
Compound characteristics
| Compound ID: | Y300-3329 |
| Compound Name: | N-[3-chloro-4-(morpholine-4-carbonyl)phenyl]-N-methylbenzenesulfonamide |
| Molecular Weight: | 394.88 |
| Molecular Formula: | C18 H19 Cl N2 O4 S |
| Smiles: | CN(c1ccc(C(N2CCOCC2)=O)c(c1)[Cl])S(c1ccccc1)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.3599 |
| logD: | 2.3599 |
| logSw: | -3.4212 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 57.616 |
| InChI Key: | NZRZTQFKWHWFFP-UHFFFAOYSA-N |