N-[2-(2,4-dimethylphenoxy)ethyl]thiophene-2-carboxamide
Chemical Structure Depiction of
N-[2-(2,4-dimethylphenoxy)ethyl]thiophene-2-carboxamide
N-[2-(2,4-dimethylphenoxy)ethyl]thiophene-2-carboxamide
Compound characteristics
| Compound ID: | Y300-3522 |
| Compound Name: | N-[2-(2,4-dimethylphenoxy)ethyl]thiophene-2-carboxamide |
| Molecular Weight: | 275.37 |
| Molecular Formula: | C15 H17 N O2 S |
| Smiles: | Cc1ccc(c(C)c1)OCCNC(c1cccs1)=O |
| Stereo: | ACHIRAL |
| logP: | 3.9747 |
| logD: | 3.9747 |
| logSw: | -4.0034 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 33.016 |
| InChI Key: | GZURLCHNVXZQPV-UHFFFAOYSA-N |