N-[(cyclohex-1-en-1-yl)methyl]-3-fluorobenzamide
Chemical Structure Depiction of
N-[(cyclohex-1-en-1-yl)methyl]-3-fluorobenzamide
N-[(cyclohex-1-en-1-yl)methyl]-3-fluorobenzamide
Compound characteristics
| Compound ID: | Y300-3892 |
| Compound Name: | N-[(cyclohex-1-en-1-yl)methyl]-3-fluorobenzamide |
| Molecular Weight: | 233.28 |
| Molecular Formula: | C14 H16 F N O |
| Smiles: | C1CCC(CNC(c2cccc(c2)F)=O)=CC1 |
| Stereo: | ACHIRAL |
| logP: | 3.2651 |
| logD: | 3.2649 |
| logSw: | -3.3942 |
| Hydrogen bond acceptors count: | 2 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 24.8439 |
| InChI Key: | MXVCYYVQXSIFAX-UHFFFAOYSA-N |