5-(dimethylamino)naphthalene-1-sulfonamide
Chemical Structure Depiction of
5-(dimethylamino)naphthalene-1-sulfonamide
5-(dimethylamino)naphthalene-1-sulfonamide
Compound characteristics
| Compound ID: | Y500-0172 |
| Compound Name: | 5-(dimethylamino)naphthalene-1-sulfonamide |
| Molecular Weight: | 250.32 |
| Molecular Formula: | C12 H14 N2 O2 S |
| Smiles: | CN(C)c1cccc2c(cccc12)S(N)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.0347 |
| logD: | 2.0297 |
| logSw: | -2.585 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 53.074 |
| InChI Key: | TYNBFJJKZPTRKS-UHFFFAOYSA-N |