N-benzyl-2-cyano-3-(3-hydroxyphenyl)prop-2-enamide
Chemical Structure Depiction of
N-benzyl-2-cyano-3-(3-hydroxyphenyl)prop-2-enamide
N-benzyl-2-cyano-3-(3-hydroxyphenyl)prop-2-enamide
Compound characteristics
| Compound ID: | Y500-1222 |
| Compound Name: | N-benzyl-2-cyano-3-(3-hydroxyphenyl)prop-2-enamide |
| Molecular Weight: | 278.31 |
| Molecular Formula: | C17 H14 N2 O2 |
| Smiles: | C(c1ccccc1)NC(C(=C/c1cccc(c1)O)\C#N)=O |
| Stereo: | ACHIRAL |
| logP: | 2.6161 |
| logD: | 2.6085 |
| logSw: | -2.7055 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 59.325 |
| InChI Key: | ARCYEXKYWISDAP-UHFFFAOYSA-N |