methyl 2-{[1-(difluoromethyl)-1H-pyrazole-3-carbonyl]amino}-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylate
Chemical Structure Depiction of
methyl 2-{[1-(difluoromethyl)-1H-pyrazole-3-carbonyl]amino}-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylate
methyl 2-{[1-(difluoromethyl)-1H-pyrazole-3-carbonyl]amino}-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylate
Compound characteristics
| Compound ID: | Y500-1752 |
| Compound Name: | methyl 2-{[1-(difluoromethyl)-1H-pyrazole-3-carbonyl]amino}-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylate |
| Molecular Weight: | 341.33 |
| Molecular Formula: | C14 H13 F2 N3 O3 S |
| Smiles: | COC(c1c2CCCc2sc1NC(c1ccn(C(F)F)n1)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.0018 |
| logD: | -0.8441 |
| logSw: | -2.6303 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 58.347 |
| InChI Key: | TXROWYCVEVBWKP-UHFFFAOYSA-N |