1-(1-ethyl-1H-pyrazol-5-yl)-3-[5-(4-nitrophenyl)furan-2-yl]prop-2-en-1-one
Chemical Structure Depiction of
1-(1-ethyl-1H-pyrazol-5-yl)-3-[5-(4-nitrophenyl)furan-2-yl]prop-2-en-1-one
1-(1-ethyl-1H-pyrazol-5-yl)-3-[5-(4-nitrophenyl)furan-2-yl]prop-2-en-1-one
Compound characteristics
| Compound ID: | Y500-3881 |
| Compound Name: | 1-(1-ethyl-1H-pyrazol-5-yl)-3-[5-(4-nitrophenyl)furan-2-yl]prop-2-en-1-one |
| Molecular Weight: | 337.33 |
| Molecular Formula: | C18 H15 N3 O4 |
| Smiles: | CCn1c(ccn1)C(/C=C/c1ccc(c2ccc(cc2)[N+]([O-])=O)o1)=O |
| Stereo: | ACHIRAL |
| logP: | 3.636 |
| logD: | 3.636 |
| logSw: | -3.76 |
| Hydrogen bond acceptors count: | 8 |
| Polar surface area: | 67.254 |
| InChI Key: | NLBAYEJPGRLCNT-UHFFFAOYSA-N |