N-(4-hydroxyphenyl)-2-methyl-3-(5-methyl-3-nitro-1H-pyrazol-1-yl)propanamide
Chemical Structure Depiction of
N-(4-hydroxyphenyl)-2-methyl-3-(5-methyl-3-nitro-1H-pyrazol-1-yl)propanamide
N-(4-hydroxyphenyl)-2-methyl-3-(5-methyl-3-nitro-1H-pyrazol-1-yl)propanamide
Compound characteristics
| Compound ID: | Y500-4264 |
| Compound Name: | N-(4-hydroxyphenyl)-2-methyl-3-(5-methyl-3-nitro-1H-pyrazol-1-yl)propanamide |
| Molecular Weight: | 304.3 |
| Molecular Formula: | C14 H16 N4 O4 |
| Smiles: | CC(Cn1c(C)cc(n1)[N+]([O-])=O)C(Nc1ccc(cc1)O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 1.0816 |
| logD: | 1.0808 |
| logSw: | -1.9539 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 87.992 |
| InChI Key: | HDHZZYSYXNVQGM-VIFPVBQESA-N |