N-(3-chlorophenyl)-N'-{1-[(4-chlorophenyl)methyl]-3,5-dimethyl-1H-pyrazol-4-yl}urea
Chemical Structure Depiction of
N-(3-chlorophenyl)-N'-{1-[(4-chlorophenyl)methyl]-3,5-dimethyl-1H-pyrazol-4-yl}urea
N-(3-chlorophenyl)-N'-{1-[(4-chlorophenyl)methyl]-3,5-dimethyl-1H-pyrazol-4-yl}urea
Compound characteristics
| Compound ID: | Y500-4994 |
| Compound Name: | N-(3-chlorophenyl)-N'-{1-[(4-chlorophenyl)methyl]-3,5-dimethyl-1H-pyrazol-4-yl}urea |
| Molecular Weight: | 389.28 |
| Molecular Formula: | C19 H18 Cl2 N4 O |
| Smiles: | Cc1c(c(C)n(Cc2ccc(cc2)[Cl])n1)NC(Nc1cccc(c1)[Cl])=O |
| Stereo: | ACHIRAL |
| logP: | 4.6149 |
| logD: | 4.6148 |
| logSw: | -4.6991 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 45.428 |
| InChI Key: | GYOIYPVQFIOBSQ-UHFFFAOYSA-N |