N'~2~,N'~5~-bis[(furan-2-yl)methylidene]furan-2,5-dicarbohydrazide
Chemical Structure Depiction of
N'~2~,N'~5~-bis[(furan-2-yl)methylidene]furan-2,5-dicarbohydrazide
N'~2~,N'~5~-bis[(furan-2-yl)methylidene]furan-2,5-dicarbohydrazide
Compound characteristics
| Compound ID: | Y500-5297 |
| Compound Name: | N'~2~,N'~5~-bis[(furan-2-yl)methylidene]furan-2,5-dicarbohydrazide |
| Molecular Weight: | 340.29 |
| Molecular Formula: | C16 H12 N4 O5 |
| Smiles: | C(\c1ccco1)=N/NC(c1ccc(C(N/N=C/c2ccco2)=O)o1)=O |
| Stereo: | ACHIRAL |
| logP: | 2.6842 |
| logD: | 2.6801 |
| logSw: | -2.896 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 95.038 |
| InChI Key: | VLIVNEKBOTWJJM-UHFFFAOYSA-N |