N-[4-(diethylamino)phenyl]-4-(propan-2-yl)benzamide
Chemical Structure Depiction of
N-[4-(diethylamino)phenyl]-4-(propan-2-yl)benzamide
N-[4-(diethylamino)phenyl]-4-(propan-2-yl)benzamide
Compound characteristics
| Compound ID: | Y500-5614 |
| Compound Name: | N-[4-(diethylamino)phenyl]-4-(propan-2-yl)benzamide |
| Molecular Weight: | 310.44 |
| Molecular Formula: | C20 H26 N2 O |
| Smiles: | CCN(CC)c1ccc(cc1)NC(c1ccc(cc1)C(C)C)=O |
| Stereo: | ACHIRAL |
| logP: | 5.1696 |
| logD: | 4.9771 |
| logSw: | -5.0726 |
| Hydrogen bond acceptors count: | 2 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 26.0658 |
| InChI Key: | VGTGEBITWRYTRN-UHFFFAOYSA-N |