3-(3,4-dimethylphenyl)-2-[(3,4-dimethylphenyl)imino]-5-[(4-ethoxy-3-methylphenyl)methylidene]-1,3-thiazolidin-4-one
Chemical Structure Depiction of
3-(3,4-dimethylphenyl)-2-[(3,4-dimethylphenyl)imino]-5-[(4-ethoxy-3-methylphenyl)methylidene]-1,3-thiazolidin-4-one
3-(3,4-dimethylphenyl)-2-[(3,4-dimethylphenyl)imino]-5-[(4-ethoxy-3-methylphenyl)methylidene]-1,3-thiazolidin-4-one
Compound characteristics
| Compound ID: | Y500-5992 |
| Compound Name: | 3-(3,4-dimethylphenyl)-2-[(3,4-dimethylphenyl)imino]-5-[(4-ethoxy-3-methylphenyl)methylidene]-1,3-thiazolidin-4-one |
| Molecular Weight: | 470.63 |
| Molecular Formula: | C29 H30 N2 O2 S |
| Smiles: | CCOc1ccc(/C=C2/C(N(/C(=N/c3ccc(C)c(C)c3)S2)c2ccc(C)c(C)c2)=O)cc1C |
| Stereo: | ACHIRAL |
| logP: | 8.4234 |
| logD: | 8.4234 |
| logSw: | -5.7091 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 31.4628 |
| InChI Key: | ZFVFOGVHHZXMRC-UHFFFAOYSA-N |