N-(4-tert-butylcyclohexyl)-4-chloro-1,3-dimethyl-1H-pyrazole-5-carboxamide
Chemical Structure Depiction of
N-(4-tert-butylcyclohexyl)-4-chloro-1,3-dimethyl-1H-pyrazole-5-carboxamide
N-(4-tert-butylcyclohexyl)-4-chloro-1,3-dimethyl-1H-pyrazole-5-carboxamide
Compound characteristics
| Compound ID: | Y500-6129 |
| Compound Name: | N-(4-tert-butylcyclohexyl)-4-chloro-1,3-dimethyl-1H-pyrazole-5-carboxamide |
| Molecular Weight: | 311.85 |
| Molecular Formula: | C16 H26 Cl N3 O |
| Smiles: | Cc1c(c(C(NC2CCC(CC2)C(C)(C)C)=O)n(C)n1)[Cl] |
| Stereo: | ACHIRAL |
| logP: | 3.925 |
| logD: | 3.925 |
| logSw: | -4.4375 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 38.246 |
| InChI Key: | GWPMROUTVRJHIA-UHFFFAOYSA-N |