3-[(2-chlorophenoxy)methyl]-N-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]benzamide
Chemical Structure Depiction of
3-[(2-chlorophenoxy)methyl]-N-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]benzamide
3-[(2-chlorophenoxy)methyl]-N-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]benzamide
Compound characteristics
| Compound ID: | Y500-6239 |
| Compound Name: | 3-[(2-chlorophenoxy)methyl]-N-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]benzamide |
| Molecular Weight: | 485 |
| Molecular Formula: | C28 H21 Cl N2 O2 S |
| Smiles: | Cc1ccc2c(c1)sc(c1ccc(cc1)NC(c1cccc(COc3ccccc3[Cl])c1)=O)n2 |
| Stereo: | ACHIRAL |
| logP: | 7.307 |
| logD: | 7.3069 |
| logSw: | -6.3307 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 40.093 |
| InChI Key: | UZNQNRIMCSZPFR-UHFFFAOYSA-N |