3-(1-ethyl-5-methyl-1H-pyrazol-4-yl)-N-(4-phenoxyphenyl)prop-2-enamide
Chemical Structure Depiction of
3-(1-ethyl-5-methyl-1H-pyrazol-4-yl)-N-(4-phenoxyphenyl)prop-2-enamide
3-(1-ethyl-5-methyl-1H-pyrazol-4-yl)-N-(4-phenoxyphenyl)prop-2-enamide
Compound characteristics
| Compound ID: | Y500-6379 |
| Compound Name: | 3-(1-ethyl-5-methyl-1H-pyrazol-4-yl)-N-(4-phenoxyphenyl)prop-2-enamide |
| Molecular Weight: | 347.42 |
| Molecular Formula: | C21 H21 N3 O2 |
| Smiles: | CCn1c(C)c(/C=C/C(Nc2ccc(cc2)Oc2ccccc2)=O)cn1 |
| Stereo: | ACHIRAL |
| logP: | 4.1704 |
| logD: | 4.1703 |
| logSw: | -4.0395 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 43.789 |
| InChI Key: | SFXZZXUCLVRQQA-UHFFFAOYSA-N |