1-(1-ethyl-5-methyl-1H-pyrazole-4-sulfonyl)-3-methyl-5-(trifluoromethyl)-4,5-dihydro-1H-pyrazol-5-ol
Chemical Structure Depiction of
1-(1-ethyl-5-methyl-1H-pyrazole-4-sulfonyl)-3-methyl-5-(trifluoromethyl)-4,5-dihydro-1H-pyrazol-5-ol
1-(1-ethyl-5-methyl-1H-pyrazole-4-sulfonyl)-3-methyl-5-(trifluoromethyl)-4,5-dihydro-1H-pyrazol-5-ol
Compound characteristics
| Compound ID: | Y500-7007 |
| Compound Name: | 1-(1-ethyl-5-methyl-1H-pyrazole-4-sulfonyl)-3-methyl-5-(trifluoromethyl)-4,5-dihydro-1H-pyrazol-5-ol |
| Molecular Weight: | 340.32 |
| Molecular Formula: | C11 H15 F3 N4 O3 S |
| Smiles: | CCn1c(C)c(cn1)S(N1C(CC(C)=N1)(C(F)(F)F)O)(=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 0.9503 |
| logD: | 0.9502 |
| logSw: | -1.467 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 72.125 |
| InChI Key: | XNQCMCNJXDCYEC-JTQLQIEISA-N |