(4-chloro-3,5-dimethyl-1H-pyrazol-1-yl){3-[(2,4-dichlorophenoxy)methyl]phenyl}methanone
Chemical Structure Depiction of
(4-chloro-3,5-dimethyl-1H-pyrazol-1-yl){3-[(2,4-dichlorophenoxy)methyl]phenyl}methanone
(4-chloro-3,5-dimethyl-1H-pyrazol-1-yl){3-[(2,4-dichlorophenoxy)methyl]phenyl}methanone
Compound characteristics
| Compound ID: | Y500-7677 |
| Compound Name: | (4-chloro-3,5-dimethyl-1H-pyrazol-1-yl){3-[(2,4-dichlorophenoxy)methyl]phenyl}methanone |
| Molecular Weight: | 409.7 |
| Molecular Formula: | C19 H15 Cl3 N2 O2 |
| Smiles: | Cc1c(c(C)n(C(c2cccc(COc3ccc(cc3[Cl])[Cl])c2)=O)n1)[Cl] |
| Stereo: | ACHIRAL |
| logP: | 4.7133 |
| logD: | 4.7133 |
| logSw: | -5.0821 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 35.167 |
| InChI Key: | AKHYNXIGSALVMX-UHFFFAOYSA-N |