3-chloro-N-[(1-ethyl-1H-pyrazol-4-yl)methyl]-1-benzothiophene-2-carboxamide
Chemical Structure Depiction of
3-chloro-N-[(1-ethyl-1H-pyrazol-4-yl)methyl]-1-benzothiophene-2-carboxamide
3-chloro-N-[(1-ethyl-1H-pyrazol-4-yl)methyl]-1-benzothiophene-2-carboxamide
Compound characteristics
| Compound ID: | Y500-7704 |
| Compound Name: | 3-chloro-N-[(1-ethyl-1H-pyrazol-4-yl)methyl]-1-benzothiophene-2-carboxamide |
| Molecular Weight: | 319.81 |
| Molecular Formula: | C15 H14 Cl N3 O S |
| Smiles: | CCn1cc(CNC(c2c(c3ccccc3s2)[Cl])=O)cn1 |
| Stereo: | ACHIRAL |
| logP: | 3.1059 |
| logD: | 3.1059 |
| logSw: | -3.8469 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 39.9 |
| InChI Key: | AVILLENRNLSFKD-UHFFFAOYSA-N |