N-(2,5-dichlorophenyl)-4-{[(2,3-dihydro-1H-inden-5-yl)oxy]methyl}benzamide
Chemical Structure Depiction of
N-(2,5-dichlorophenyl)-4-{[(2,3-dihydro-1H-inden-5-yl)oxy]methyl}benzamide
N-(2,5-dichlorophenyl)-4-{[(2,3-dihydro-1H-inden-5-yl)oxy]methyl}benzamide
Compound characteristics
| Compound ID: | Y500-7802 |
| Compound Name: | N-(2,5-dichlorophenyl)-4-{[(2,3-dihydro-1H-inden-5-yl)oxy]methyl}benzamide |
| Molecular Weight: | 412.31 |
| Molecular Formula: | C23 H19 Cl2 N O2 |
| Smiles: | C1Cc2ccc(cc2C1)OCc1ccc(cc1)C(Nc1cc(ccc1[Cl])[Cl])=O |
| Stereo: | ACHIRAL |
| logP: | 6.3531 |
| logD: | 6.0242 |
| logSw: | -6.4661 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 30.1459 |
| InChI Key: | UDXXOZJALBMZQA-UHFFFAOYSA-N |