[5-bromo-2-(difluoromethoxy)phenyl]{4-[(2,4-dichlorophenyl)methyl]piperazin-1-yl}methanone
Chemical Structure Depiction of
[5-bromo-2-(difluoromethoxy)phenyl]{4-[(2,4-dichlorophenyl)methyl]piperazin-1-yl}methanone
[5-bromo-2-(difluoromethoxy)phenyl]{4-[(2,4-dichlorophenyl)methyl]piperazin-1-yl}methanone
Compound characteristics
| Compound ID: | Y500-8451 |
| Compound Name: | [5-bromo-2-(difluoromethoxy)phenyl]{4-[(2,4-dichlorophenyl)methyl]piperazin-1-yl}methanone |
| Molecular Weight: | 494.16 |
| Molecular Formula: | C19 H17 Br Cl2 F2 N2 O2 |
| Smiles: | C1CN(CCN1Cc1ccc(cc1[Cl])[Cl])C(c1cc(ccc1OC(F)F)[Br])=O |
| Stereo: | ACHIRAL |
| logP: | 4.9123 |
| logD: | 4.911 |
| logSw: | -4.9543 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 27.1188 |
| InChI Key: | RPIBUHZMQQDZCX-UHFFFAOYSA-N |