N-(5-bromopyridin-2-yl)-2-(difluoromethoxy)benzamide
Chemical Structure Depiction of
N-(5-bromopyridin-2-yl)-2-(difluoromethoxy)benzamide
N-(5-bromopyridin-2-yl)-2-(difluoromethoxy)benzamide
Compound characteristics
| Compound ID: | Y500-8462 |
| Compound Name: | N-(5-bromopyridin-2-yl)-2-(difluoromethoxy)benzamide |
| Molecular Weight: | 343.12 |
| Molecular Formula: | C13 H9 Br F2 N2 O2 |
| Smiles: | c1ccc(c(c1)C(Nc1ccc(cn1)[Br])=O)OC(F)F |
| Stereo: | ACHIRAL |
| logP: | 3.6617 |
| logD: | 2.4576 |
| logSw: | -4.0527 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 39.726 |
| InChI Key: | LMNMNUSUCYZCMU-UHFFFAOYSA-N |