7-(difluoromethyl)-5-(4-methylphenyl)-N-(2,4,4-trimethylpentan-2-yl)pyrazolo[1,5-a]pyrimidine-3-carboxamide
Chemical Structure Depiction of
7-(difluoromethyl)-5-(4-methylphenyl)-N-(2,4,4-trimethylpentan-2-yl)pyrazolo[1,5-a]pyrimidine-3-carboxamide
7-(difluoromethyl)-5-(4-methylphenyl)-N-(2,4,4-trimethylpentan-2-yl)pyrazolo[1,5-a]pyrimidine-3-carboxamide
Compound characteristics
| Compound ID: | Y500-8994 |
| Compound Name: | 7-(difluoromethyl)-5-(4-methylphenyl)-N-(2,4,4-trimethylpentan-2-yl)pyrazolo[1,5-a]pyrimidine-3-carboxamide |
| Molecular Weight: | 414.5 |
| Molecular Formula: | C23 H28 F2 N4 O |
| Smiles: | Cc1ccc(cc1)c1cc(C(F)F)n2c(c(cn2)C(NC(C)(C)CC(C)(C)C)=O)n1 |
| Stereo: | ACHIRAL |
| logP: | 5.6008 |
| logD: | 5.6008 |
| logSw: | -5.2523 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 43.144 |
| InChI Key: | MAVWDCBSKCHRCT-UHFFFAOYSA-N |