ethyl 2-{[(4-chloro-1,3-dimethyl-1H-pyrazole-5-carbonyl)carbamothioyl]amino}-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate
Chemical Structure Depiction of
ethyl 2-{[(4-chloro-1,3-dimethyl-1H-pyrazole-5-carbonyl)carbamothioyl]amino}-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate
ethyl 2-{[(4-chloro-1,3-dimethyl-1H-pyrazole-5-carbonyl)carbamothioyl]amino}-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate
Compound characteristics
| Compound ID: | Y500-9744 |
| Compound Name: | ethyl 2-{[(4-chloro-1,3-dimethyl-1H-pyrazole-5-carbonyl)carbamothioyl]amino}-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| Molecular Weight: | 455 |
| Molecular Formula: | C19 H23 Cl N4 O3 S2 |
| Smiles: | CCOC(c1c2CCC(C)Cc2sc1NC(NC(c1c(c(C)nn1C)[Cl])=O)=S)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.2133 |
| logD: | 2.1071 |
| logSw: | -4.9492 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 67.577 |
| InChI Key: | LQJLQHNJPVEHMG-SECBINFHSA-N |