propyl 2-[(benzenesulfonyl)amino]-4-ethyl-5-methylthiophene-3-carboxylate
Chemical Structure Depiction of
propyl 2-[(benzenesulfonyl)amino]-4-ethyl-5-methylthiophene-3-carboxylate
propyl 2-[(benzenesulfonyl)amino]-4-ethyl-5-methylthiophene-3-carboxylate
Compound characteristics
| Compound ID: | Y501-0040 |
| Compound Name: | propyl 2-[(benzenesulfonyl)amino]-4-ethyl-5-methylthiophene-3-carboxylate |
| Molecular Weight: | 367.48 |
| Molecular Formula: | C17 H21 N O4 S2 |
| Smiles: | CCCOC(c1c(CC)c(C)sc1NS(c1ccccc1)(=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.3361 |
| logD: | -1.7204 |
| logSw: | -4.4225 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 61.73 |
| InChI Key: | JUWVUOVXRZPTIM-UHFFFAOYSA-N |