N-[2-(5-methyl-1H-indol-3-yl)ethyl]-3-(trifluoromethyl)benzamide
Chemical Structure Depiction of
N-[2-(5-methyl-1H-indol-3-yl)ethyl]-3-(trifluoromethyl)benzamide
N-[2-(5-methyl-1H-indol-3-yl)ethyl]-3-(trifluoromethyl)benzamide
Compound characteristics
| Compound ID: | Y501-0609 |
| Compound Name: | N-[2-(5-methyl-1H-indol-3-yl)ethyl]-3-(trifluoromethyl)benzamide |
| Molecular Weight: | 346.35 |
| Molecular Formula: | C19 H17 F3 N2 O |
| Smiles: | Cc1ccc2c(c1)c(CCNC(c1cccc(c1)C(F)(F)F)=O)c[nH]2 |
| Stereo: | ACHIRAL |
| logP: | 4.2235 |
| logD: | 4.2235 |
| logSw: | -4.3484 |
| Hydrogen bond acceptors count: | 2 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 34.364 |
| InChI Key: | MQPSSHFMSBYDET-UHFFFAOYSA-N |