3-[(4-ethoxyphenoxy)methyl]-N'-[(pyridin-3-yl)methylidene]benzohydrazide
Chemical Structure Depiction of
3-[(4-ethoxyphenoxy)methyl]-N'-[(pyridin-3-yl)methylidene]benzohydrazide
3-[(4-ethoxyphenoxy)methyl]-N'-[(pyridin-3-yl)methylidene]benzohydrazide
Compound characteristics
| Compound ID: | Y501-0981 |
| Compound Name: | 3-[(4-ethoxyphenoxy)methyl]-N'-[(pyridin-3-yl)methylidene]benzohydrazide |
| Molecular Weight: | 375.43 |
| Molecular Formula: | C22 H21 N3 O3 |
| Smiles: | CCOc1ccc(cc1)OCc1cccc(c1)C(N/N=C/c1cccnc1)=O |
| Stereo: | ACHIRAL |
| logP: | 3.8739 |
| logD: | 3.8036 |
| logSw: | -3.7128 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 59.423 |
| InChI Key: | KIZAMRQLXKZVTN-UHFFFAOYSA-N |