4-bromo-N-(3-chloro-4-methoxyphenyl)-1,5-dimethyl-1H-pyrazole-3-carboxamide
Chemical Structure Depiction of
4-bromo-N-(3-chloro-4-methoxyphenyl)-1,5-dimethyl-1H-pyrazole-3-carboxamide
4-bromo-N-(3-chloro-4-methoxyphenyl)-1,5-dimethyl-1H-pyrazole-3-carboxamide
Compound characteristics
| Compound ID: | Y501-2397 |
| Compound Name: | 4-bromo-N-(3-chloro-4-methoxyphenyl)-1,5-dimethyl-1H-pyrazole-3-carboxamide |
| Molecular Weight: | 358.62 |
| Molecular Formula: | C13 H13 Br Cl N3 O2 |
| Smiles: | Cc1c(c(C(Nc2ccc(c(c2)[Cl])OC)=O)nn1C)[Br] |
| Stereo: | ACHIRAL |
| logP: | 2.8477 |
| logD: | 2.8383 |
| logSw: | -3.5679 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 45.993 |
| InChI Key: | ZAAUACLOCRBTIF-UHFFFAOYSA-N |