5-[(4-bromo-3,5-dimethyl-1H-pyrazol-1-yl)methyl]-N-(1-ethyl-1H-pyrazol-3-yl)furan-2-carboxamide
Chemical Structure Depiction of
5-[(4-bromo-3,5-dimethyl-1H-pyrazol-1-yl)methyl]-N-(1-ethyl-1H-pyrazol-3-yl)furan-2-carboxamide
5-[(4-bromo-3,5-dimethyl-1H-pyrazol-1-yl)methyl]-N-(1-ethyl-1H-pyrazol-3-yl)furan-2-carboxamide
Compound characteristics
| Compound ID: | Y501-2751 |
| Compound Name: | 5-[(4-bromo-3,5-dimethyl-1H-pyrazol-1-yl)methyl]-N-(1-ethyl-1H-pyrazol-3-yl)furan-2-carboxamide |
| Molecular Weight: | 392.25 |
| Molecular Formula: | C16 H18 Br N5 O2 |
| Smiles: | CCn1ccc(NC(c2ccc(Cn3c(C)c(c(C)n3)[Br])o2)=O)n1 |
| Stereo: | ACHIRAL |
| logP: | 2.2549 |
| logD: | 2.2287 |
| logSw: | -2.7942 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 60.405 |
| InChI Key: | ZKGGUFYCNBDPHQ-UHFFFAOYSA-N |