N-[1-(1-ethyl-3-methyl-1H-pyrazol-4-yl)ethyl]-1-phenyl-3-(trifluoromethyl)-1H-thieno[2,3-c]pyrazole-5-carboxamide
Chemical Structure Depiction of
N-[1-(1-ethyl-3-methyl-1H-pyrazol-4-yl)ethyl]-1-phenyl-3-(trifluoromethyl)-1H-thieno[2,3-c]pyrazole-5-carboxamide
N-[1-(1-ethyl-3-methyl-1H-pyrazol-4-yl)ethyl]-1-phenyl-3-(trifluoromethyl)-1H-thieno[2,3-c]pyrazole-5-carboxamide
Compound characteristics
| Compound ID: | Y501-2764 |
| Compound Name: | N-[1-(1-ethyl-3-methyl-1H-pyrazol-4-yl)ethyl]-1-phenyl-3-(trifluoromethyl)-1H-thieno[2,3-c]pyrazole-5-carboxamide |
| Molecular Weight: | 447.48 |
| Molecular Formula: | C21 H20 F3 N5 O S |
| Smiles: | CCn1cc(C(C)NC(c2cc3c(C(F)(F)F)nn(c4ccccc4)c3s2)=O)c(C)n1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.8932 |
| logD: | 3.8932 |
| logSw: | -3.8645 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 53.638 |
| InChI Key: | HCQZVIWWOMNWRR-LBPRGKRZSA-N |