5-{[4-(butan-2-yl)phenoxy]methyl}-N-(5-nitropyridin-2-yl)furan-2-carboxamide
Chemical Structure Depiction of
5-{[4-(butan-2-yl)phenoxy]methyl}-N-(5-nitropyridin-2-yl)furan-2-carboxamide
5-{[4-(butan-2-yl)phenoxy]methyl}-N-(5-nitropyridin-2-yl)furan-2-carboxamide
Compound characteristics
| Compound ID: | Y501-3827 |
| Compound Name: | 5-{[4-(butan-2-yl)phenoxy]methyl}-N-(5-nitropyridin-2-yl)furan-2-carboxamide |
| Molecular Weight: | 395.41 |
| Molecular Formula: | C21 H21 N3 O5 |
| Smiles: | CCC(C)c1ccc(cc1)OCc1ccc(C(Nc2ccc(cn2)[N+]([O-])=O)=O)o1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.6778 |
| logD: | 5.1343 |
| logSw: | -5.3269 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 81.485 |
| InChI Key: | DOFYJKBSZQGAMJ-AWEZNQCLSA-N |