N-(2,4,6-trimethylphenyl)decanamide
Chemical Structure Depiction of
N-(2,4,6-trimethylphenyl)decanamide
N-(2,4,6-trimethylphenyl)decanamide
Compound characteristics
| Compound ID: | Y501-4358 |
| Compound Name: | N-(2,4,6-trimethylphenyl)decanamide |
| Molecular Weight: | 289.46 |
| Molecular Formula: | C19 H31 N O |
| Smiles: | CCCCCCCCCC(Nc1c(C)cc(C)cc1C)=O |
| Stereo: | ACHIRAL |
| logP: | 5.7608 |
| logD: | 5.7608 |
| logSw: | -5.0886 |
| Hydrogen bond acceptors count: | 2 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 21.9921 |
| InChI Key: | ZQUFGQCGPYULOV-UHFFFAOYSA-N |